C31H41NO6 — CID 23890577
6-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(3E)-3-[(2-hydroxyphenyl)methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid (PubChem CID 23890577) has the molecular formula C31H41NO6 and a molecular weight of 523.67 g/mol. Its IUPAC name is 6-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(3E)-3-[(2-hydroxyphenyl)methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid.
| Compound Name | 6-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(3E)-3-[(2-hydroxyphenyl)methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 23890577 |
| Molecular Formula | C31H41NO6 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 6-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(3E)-3-[(2-hydroxyphenyl)methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
| SMILES | CCC/C(=C\c1ccccc1O)CC[C@H]1OC[C@H]2C1=C(CC)C[C@H]1C(=O)N(CCCCCC(=O)O)C(=O)[C@H]12 |
| InChI | InChI=1S/C31H41NO6/c1-3-10-20(17-22-11-7-8-12-25(22)33)14-15-26-28-21(4-2)18-23-29(24(28)19-38-26)31(37)32(30(23)36)16-9-5-6-13-27(34)35/h7-8,11-12,17,23-24,26,29,33H,3-6,9-10,13-16,18-19H2,1-2H3,(H,34,35)/b20-17+/t23-,24+,26-,29-/m1/s1 |
| InChIKey | RYYXWRJFSYYXPK-XIKZDXARSA-N |
| XLogP | 5.73 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|