C33H39BN2O7 — CID 135707523
6-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid (PubChem CID 135707523) has the molecular formula C33H39BN2O7 and a molecular weight of 586.49 g/mol. Its IUPAC name is 6-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid.
| Compound Name | 6-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid |
|---|---|
| PubChem CID | 135707523 |
| Molecular Formula | C33H39BN2O7 |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | 6-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccccc3O)c3ccccn3)OB(O)C[C@@H]2[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H39BN2O7/c1-2-21-19-24-31(33(41)36(32(24)40)17-9-3-4-13-29(38)39)25-20-34(42)43-28(30(21)25)15-14-22(26-11-7-8-16-35-26)18-23-10-5-6-12-27(23)37/h5-8,10-12,16,18,24-25,28,31,37,42H,2-4,9,13-15,17,19-20H2,1H3,(H,38,39)/b22-18-/t24-,25+,28-,31-/m1/s1 |
| InChIKey | WVJSNUARZLLMRO-JAFAZQHNSA-N |
| XLogP | 4.96 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|