C30H40BNO7 — CID 23862229
6-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(2-hydroxyphenyl)methylidene]pentyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid (PubChem CID 23862229) has the molecular formula C30H40BNO7 and a molecular weight of 537.46 g/mol. Its IUPAC name is 6-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(2-hydroxyphenyl)methylidene]pentyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid.
| Compound Name | 6-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(2-hydroxyphenyl)methylidene]pentyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid |
|---|---|
| PubChem CID | 23862229 |
| Molecular Formula | C30H40BNO7 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 6-[(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(2-hydroxyphenyl)methylidene]pentyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccccc3O)CC)OB(O)C[C@@H]2[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C30H40BNO7/c1-3-19(16-21-10-7-8-11-24(21)33)13-14-25-27-20(4-2)17-22-28(23(27)18-31(38)39-25)30(37)32(29(22)36)15-9-5-6-12-26(34)35/h7-8,10-11,16,22-23,25,28,33,38H,3-6,9,12-15,17-18H2,1-2H3,(H,34,35)/b19-16+/t22-,23+,25-,28-/m1/s1 |
| InChIKey | BPDROTIKKZRCDM-ZYQFTGAFSA-N |
| XLogP | 4.82 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|