C35H42BNO7 — CID 23746758
6-[(4R,6aR,9aS,9bR)-2-hydroxy-4-[(Z)-4-(4-hydroxyphenyl)-3-phenylbut-3-enyl]-7,9-dioxo-5-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid (PubChem CID 23746758) has the molecular formula C35H42BNO7 and a molecular weight of 599.53 g/mol. Its IUPAC name is 6-[(4R,6aR,9aS,9bR)-2-hydroxy-4-[(Z)-4-(4-hydroxyphenyl)-3-phenylbut-3-enyl]-7,9-dioxo-5-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid.
| Compound Name | 6-[(4R,6aR,9aS,9bR)-2-hydroxy-4-[(Z)-4-(4-hydroxyphenyl)-3-phenylbut-3-enyl]-7,9-dioxo-5-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid |
|---|---|
| PubChem CID | 23746758 |
| Molecular Formula | C35H42BNO7 |
| Molecular Weight | 599.53 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | 6-[(4R,6aR,9aS,9bR)-2-hydroxy-4-[(Z)-4-(4-hydroxyphenyl)-3-phenylbut-3-enyl]-7,9-dioxo-5-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3ccc(O)cc3)c3ccccc3)OB(O)C[C@@H]2[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C35H42BNO7/c1-2-9-26-21-28-33(35(42)37(34(28)41)19-8-4-7-12-31(39)40)29-22-36(43)44-30(32(26)29)18-15-25(24-10-5-3-6-11-24)20-23-13-16-27(38)17-14-23/h3,5-6,10-11,13-14,16-17,20,28-30,33,38,43H,2,4,7-9,12,15,18-19,21-22H2,1H3,(H,39,40)/b25-20-/t28-,29+,30-,33-/m1/s1 |
| InChIKey | QMKNOFGEXMRIOJ-MTGBRGELSA-N |
| XLogP | 5.96 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|