C29H37NO6 — CID 23974596
6-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid (PubChem CID 23974596) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is 6-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid.
| Compound Name | 6-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 23974596 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 6-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
| SMILES | CCC1=C2[C@@H](CC/C(C)=C/c3ccccc3O)OC[C@@H]2[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C29H37NO6/c1-3-19-16-21-27(29(35)30(28(21)34)14-8-4-5-11-25(32)33)22-17-36-24(26(19)22)13-12-18(2)15-20-9-6-7-10-23(20)31/h6-7,9-10,15,21-22,24,27,31H,3-5,8,11-14,16-17H2,1-2H3,(H,32,33)/b18-15+/t21-,22+,24-,27-/m1/s1 |
| InChIKey | KTMGWGCXSNMLPB-BDGMNAGOSA-N |
| XLogP | 4.95 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|