C28H31NO5S — CID 23805633
(3R,5aR,8aS,8bR)-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-4-(methoxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23805633) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-4-(methoxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-4-(methoxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23805633 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-4-(methoxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | COCC1=C2[C@@H](CC/C(C)=C/c3ccccc3O)OC[C@@H]2[C@@H]2C(=O)N(Cc3cccs3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C28H31NO5S/c1-17(12-18-6-3-4-8-23(18)30)9-10-24-25-19(15-33-2)13-21-26(22(25)16-34-24)28(32)29(27(21)31)14-20-7-5-11-35-20/h3-8,11-12,21-22,24,26,30H,9-10,13-16H2,1-2H3/b17-12+/t21-,22+,24-,26-/m1/s1 |
| InChIKey | DTNKGMUCMATUIN-VVGVXEQXSA-N |
| XLogP | 4.80 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|