C34H35NO5S — CID 23747459
(3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-phenylbut-3-enyl]-4-(hydroxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23747459) has the molecular formula C34H35NO5S and a molecular weight of 569.72 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-phenylbut-3-enyl]-4-(hydroxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-phenylbut-3-enyl]-4-(hydroxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23747459 |
| Molecular Formula | C34H35NO5S |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-phenylbut-3-enyl]-4-(hydroxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | Cc1cc(/C=C(/CC[C@H]2OC[C@H]3C2=C(CO)C[C@H]2C(=O)N(Cc4cccs4)C(=O)[C@H]23)c2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C34H35NO5S/c1-20-13-22(14-21(2)32(20)37)15-24(23-7-4-3-5-8-23)10-11-29-30-25(18-36)16-27-31(28(30)19-40-29)34(39)35(33(27)38)17-26-9-6-12-41-26/h3-9,12-15,27-29,31,36-37H,10-11,16-19H2,1-2H3/b24-15-/t27-,28+,29-,31-/m1/s1 |
| InChIKey | QGWPEVOXUUACIR-IZSRPFHBSA-N |
| XLogP | 5.90 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|