C29H32BrNO5S — CID 23946706
(3R,5aR,8aS,8bR)-3-[(3E)-3-[(5-bromo-2-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23946706) has the molecular formula C29H32BrNO5S and a molecular weight of 586.55 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(3E)-3-[(5-bromo-2-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(3E)-3-[(5-bromo-2-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23946706 |
| Molecular Formula | C29H32BrNO5S |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(3E)-3-[(5-bromo-2-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCC/C(=C\c1cc(Br)ccc1O)CC[C@H]1OC[C@H]2C1=C(CO)C[C@H]1C(=O)N(Cc3cccs3)C(=O)[C@H]12 |
| InChI | InChI=1S/C29H32BrNO5S/c1-2-4-17(11-18-12-20(30)7-8-24(18)33)6-9-25-26-19(15-32)13-22-27(23(26)16-36-25)29(35)31(28(22)34)14-21-5-3-10-37-21/h3,5,7-8,10-12,22-23,25,27,32-33H,2,4,6,9,13-16H2,1H3/b17-11+/t22-,23+,25-,27-/m1/s1 |
| InChIKey | BEIGWINMBWVQMP-DJHJDPQJSA-N |
| XLogP | 5.69 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|