C33H34BNO5S — CID 23862207
(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-8-(thiophen-2-ylmethyl)-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione (PubChem CID 23862207) has the molecular formula C33H34BNO5S and a molecular weight of 567.52 g/mol. Its IUPAC name is (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-8-(thiophen-2-ylmethyl)-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione.
| Compound Name | (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-8-(thiophen-2-ylmethyl)-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
|---|---|
| PubChem CID | 23862207 |
| Molecular Formula | C33H34BNO5S |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-8-(thiophen-2-ylmethyl)-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3cccc(O)c3)c3ccccc3)OB(O)C[C@@H]2[C@@H]2C(=O)N(Cc3cccs3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H34BNO5S/c1-2-22-18-27-31(33(38)35(32(27)37)20-26-12-7-15-41-26)28-19-34(39)40-29(30(22)28)14-13-24(23-9-4-3-5-10-23)16-21-8-6-11-25(36)17-21/h3-12,15-17,27-29,31,36,39H,2,13-14,18-20H2,1H3/b24-16-/t27-,28+,29-,31-/m1/s1 |
| InChIKey | VSCNVXJQKVQBSS-SGYORPQGSA-N |
| XLogP | 6.18 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|