C34H33BO6 — CID 23917915
(4R,6aR,12aS,12bR)-2-hydroxy-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-5-(methoxymethyl)-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione (PubChem CID 23917915) has the molecular formula C34H33BO6 and a molecular weight of 548.44 g/mol. Its IUPAC name is (4R,6aR,12aS,12bR)-2-hydroxy-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-5-(methoxymethyl)-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione.
| Compound Name | (4R,6aR,12aS,12bR)-2-hydroxy-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-5-(methoxymethyl)-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione |
|---|---|
| PubChem CID | 23917915 |
| Molecular Formula | C34H33BO6 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | (4R,6aR,12aS,12bR)-2-hydroxy-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-5-(methoxymethyl)-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione |
| SMILES | COCC1=C2[C@@H](CC/C(=C/c3cccc(O)c3)c3ccccc3)OB(O)C[C@@H]2[C@@H]2C(=O)c3ccccc3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C34H33BO6/c1-40-20-24-18-28-32(34(38)27-13-6-5-12-26(27)33(28)37)29-19-35(39)41-30(31(24)29)15-14-23(22-9-3-2-4-10-22)16-21-8-7-11-25(36)17-21/h2-13,16-17,28-30,32,36,39H,14-15,18-20H2,1H3/b23-16-/t28-,29+,30-,32-/m1/s1 |
| InChIKey | VMJAOQOIIBEMHY-CRRFKDNQSA-N |
| XLogP | 5.87 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|