C29H30BNO8 — CID 23889978
methyl (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate (PubChem CID 23889978) has the molecular formula C29H30BNO8 and a molecular weight of 531.37 g/mol. Its IUPAC name is methyl (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate.
| Compound Name | methyl (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
|---|---|
| PubChem CID | 23889978 |
| Molecular Formula | C29H30BNO8 |
| Molecular Weight | 531.37 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | methyl (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@@H]2[C@@H](CC(CO)=C3[C@@H](CC/C(=C/c4cccc(O)c4)c4ccccc4)OB(O)C[C@@H]32)C1=O |
| InChI | InChI=1S/C29H30BNO8/c1-38-29(36)31-27(34)22-14-20(16-32)25-23(26(22)28(31)35)15-30(37)39-24(25)11-10-19(18-7-3-2-4-8-18)12-17-6-5-9-21(33)13-17/h2-9,12-13,22-24,26,32-33,37H,10-11,14-16H2,1H3/b19-12-/t22-,23+,24-,26-/m1/s1 |
| InChIKey | XAIFHJPUEXAQAG-UZUWLFHESA-N |
| XLogP | 3.27 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|