C26H32BNO8 — CID 23945915
methyl (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate (PubChem CID 23945915) has the molecular formula C26H32BNO8 and a molecular weight of 497.35 g/mol. Its IUPAC name is methyl (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate.
| Compound Name | methyl (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
|---|---|
| PubChem CID | 23945915 |
| Molecular Formula | C26H32BNO8 |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | methyl (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
| SMILES | CCC/C(=C\c1cccc(O)c1)CC[C@H]1OB(O)C[C@H]2C1=C(CO)C[C@H]1C(=O)N(C(=O)OC)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H32BNO8/c1-3-5-15(10-16-6-4-7-18(30)11-16)8-9-21-22-17(14-29)12-19-23(20(22)13-27(34)36-21)25(32)28(24(19)31)26(33)35-2/h4,6-7,10-11,19-21,23,29-30,34H,3,5,8-9,12-14H2,1-2H3/b15-10+/t19-,20+,21-,23-/m1/s1 |
| InChIKey | YQZGEGPNFZJMIG-IAXMJZKJSA-N |
| XLogP | 2.91 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|