C27H34BNO7 — CID 23974048
methyl (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(E)-4-(4-hydroxy-3,5-dimethylphenyl)-3-methylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate (PubChem CID 23974048) has the molecular formula C27H34BNO7 and a molecular weight of 495.38 g/mol. Its IUPAC name is methyl (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(E)-4-(4-hydroxy-3,5-dimethylphenyl)-3-methylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate.
| Compound Name | methyl (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(E)-4-(4-hydroxy-3,5-dimethylphenyl)-3-methylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
|---|---|
| PubChem CID | 23974048 |
| Molecular Formula | C27H34BNO7 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | methyl (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(E)-4-(4-hydroxy-3,5-dimethylphenyl)-3-methylbut-3-enyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
| SMILES | CCC1=C2[C@@H](CC/C(C)=C/c3cc(C)c(O)c(C)c3)OB(O)C[C@@H]2[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C27H34BNO7/c1-6-18-12-19-23(26(32)29(25(19)31)27(33)35-5)20-13-28(34)36-21(22(18)20)8-7-14(2)9-17-10-15(3)24(30)16(4)11-17/h9-11,19-21,23,30,34H,6-8,12-13H2,1-5H3/b14-9+/t19-,20+,21-,23-/m1/s1 |
| InChIKey | ANLDRUGYCMTTGL-HUMDTXPZSA-N |
| XLogP | 4.17 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|