C29H40BNO5 — CID 23746848
(4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentyl]-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione (PubChem CID 23746848) has the molecular formula C29H40BNO5 and a molecular weight of 493.45 g/mol. Its IUPAC name is (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentyl]-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione.
| Compound Name | (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentyl]-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
|---|---|
| PubChem CID | 23746848 |
| Molecular Formula | C29H40BNO5 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentyl]-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
| SMILES | CCCN1C(=O)[C@@H]2[C@@H](CC(CC)=C3[C@@H](CC/C(=C/c4cc(C)c(O)c(C)c4)CC)OB(O)C[C@@H]32)C1=O |
| InChI | InChI=1S/C29H40BNO5/c1-6-11-31-28(33)22-15-21(8-3)25-23(26(22)29(31)34)16-30(35)36-24(25)10-9-19(7-2)14-20-12-17(4)27(32)18(5)13-20/h12-14,22-24,26,32,35H,6-11,15-16H2,1-5H3/b19-14+/t22-,23+,24-,26-/m1/s1 |
| InChIKey | OXXKISPWSDFEPY-VBFKTFBQSA-N |
| XLogP | 5.20 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|