C26H33BClNO6 — CID 23776037
(4R,6aR,9aS,9bR)-4-[(3E)-3-[(2-chloro-4-hydroxyphenyl)methylidene]pentyl]-2-hydroxy-5-(hydroxymethyl)-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione (PubChem CID 23776037) has the molecular formula C26H33BClNO6 and a molecular weight of 501.82 g/mol. Its IUPAC name is (4R,6aR,9aS,9bR)-4-[(3E)-3-[(2-chloro-4-hydroxyphenyl)methylidene]pentyl]-2-hydroxy-5-(hydroxymethyl)-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione.
| Compound Name | (4R,6aR,9aS,9bR)-4-[(3E)-3-[(2-chloro-4-hydroxyphenyl)methylidene]pentyl]-2-hydroxy-5-(hydroxymethyl)-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
|---|---|
| PubChem CID | 23776037 |
| Molecular Formula | C26H33BClNO6 |
| Molecular Weight | 501.82 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (4R,6aR,9aS,9bR)-4-[(3E)-3-[(2-chloro-4-hydroxyphenyl)methylidene]pentyl]-2-hydroxy-5-(hydroxymethyl)-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
| SMILES | CCCN1C(=O)[C@@H]2[C@@H](CC(CO)=C3[C@@H](CC/C(=C/c4ccc(O)cc4Cl)CC)OB(O)C[C@@H]32)C1=O |
| InChI | InChI=1S/C26H33BClNO6/c1-3-9-29-25(32)19-11-17(14-30)23-20(24(19)26(29)33)13-27(34)35-22(23)8-5-15(4-2)10-16-6-7-18(31)12-21(16)28/h6-7,10,12,19-20,22,24,30-31,34H,3-5,8-9,11,13-14H2,1-2H3/b15-10+/t19-,20+,22-,24-/m1/s1 |
| InChIKey | GCJAOJCKIZCQBN-UQZUHYHESA-N |
| XLogP | 3.82 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|