C26H36BNO7 — CID 23918047
(4R,6aR,9aS,9bR)-2-hydroxy-4-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-5-(methoxymethyl)-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione (PubChem CID 23918047) has the molecular formula C26H36BNO7 and a molecular weight of 485.39 g/mol. Its IUPAC name is (4R,6aR,9aS,9bR)-2-hydroxy-4-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-5-(methoxymethyl)-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione.
| Compound Name | (4R,6aR,9aS,9bR)-2-hydroxy-4-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-5-(methoxymethyl)-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
|---|---|
| PubChem CID | 23918047 |
| Molecular Formula | C26H36BNO7 |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (4R,6aR,9aS,9bR)-2-hydroxy-4-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-5-(methoxymethyl)-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
| SMILES | CCCN1C(=O)[C@@H]2[C@@H](CC(COC)=C3[C@@H](CC/C(=C/c4ccc(CO)o4)CC)OB(O)C[C@@H]32)C1=O |
| InChI | InChI=1S/C26H36BNO7/c1-4-10-28-25(30)20-12-17(15-33-3)23-21(24(20)26(28)31)13-27(32)35-22(23)9-6-16(5-2)11-18-7-8-19(14-29)34-18/h7-8,11,20-22,24,29,32H,4-6,9-10,12-15H2,1-3H3/b16-11+/t20-,21+,22-,24-/m1/s1 |
| InChIKey | IKJHOGJOQDSFTK-YMWJPKKWSA-N |
| XLogP | 3.20 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|