C34H41NO8 — CID 23974638
6-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-6,8-dioxo-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid (PubChem CID 23974638) has the molecular formula C34H41NO8 and a molecular weight of 591.70 g/mol. Its IUPAC name is 6-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-6,8-dioxo-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid.
| Compound Name | 6-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-6,8-dioxo-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 23974638 |
| Molecular Formula | C34H41NO8 |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | 6-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]pentyl]-6,8-dioxo-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
| SMILES | CC/C(=C\c1ccc(CO)o1)CC[C@H]1OC[C@H]2C1=C(COc1ccccc1)C[C@H]1C(=O)N(CCCCCC(=O)O)C(=O)[C@H]12 |
| InChI | InChI=1S/C34H41NO8/c1-2-22(17-25-13-14-26(19-36)43-25)12-15-29-31-23(20-41-24-9-5-3-6-10-24)18-27-32(28(31)21-42-29)34(40)35(33(27)39)16-8-4-7-11-30(37)38/h3,5-6,9-10,13-14,17,27-29,32,36H,2,4,7-8,11-12,15-16,18-21H2,1H3,(H,37,38)/b22-17+/t27-,28+,29-,32-/m1/s1 |
| InChIKey | WTZJKOLKMVHXKX-RAOOIKQMSA-N |
| XLogP | 5.39 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|