C29H39NO8 — CID 23747416
6-[(3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid (PubChem CID 23747416) has the molecular formula C29H39NO8 and a molecular weight of 529.63 g/mol. Its IUPAC name is 6-[(3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid.
| Compound Name | 6-[(3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 23747416 |
| Molecular Formula | C29H39NO8 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 6-[(3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(3E)-3-[[5-(hydroxymethyl)furan-2-yl]methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
| SMILES | CCC/C(=C\c1ccc(CO)o1)CC[C@H]1OC[C@H]2C1=C(CO)C[C@H]1C(=O)N(CCCCCC(=O)O)C(=O)[C@H]12 |
| InChI | InChI=1S/C29H39NO8/c1-2-6-18(13-20-9-10-21(16-32)38-20)8-11-24-26-19(15-31)14-22-27(23(26)17-37-24)29(36)30(28(22)35)12-5-3-4-7-25(33)34/h9-10,13,22-24,27,31-32H,2-8,11-12,14-17H2,1H3,(H,33,34)/b18-13+/t22-,23+,24-,27-/m1/s1 |
| InChIKey | YIGPWZPCFJFVMX-YMFVLAJTSA-N |
| XLogP | 3.69 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|