C27H36BNO8 — CID 23746815
6-[(4R,6aR,9aS,9bR)-2-hydroxy-4-[(E)-4-[5-(hydroxymethyl)furan-2-yl]-3-methylbut-3-enyl]-5-methyl-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid (PubChem CID 23746815) has the molecular formula C27H36BNO8 and a molecular weight of 513.40 g/mol. Its IUPAC name is 6-[(4R,6aR,9aS,9bR)-2-hydroxy-4-[(E)-4-[5-(hydroxymethyl)furan-2-yl]-3-methylbut-3-enyl]-5-methyl-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid.
| Compound Name | 6-[(4R,6aR,9aS,9bR)-2-hydroxy-4-[(E)-4-[5-(hydroxymethyl)furan-2-yl]-3-methylbut-3-enyl]-5-methyl-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid |
|---|---|
| PubChem CID | 23746815 |
| Molecular Formula | C27H36BNO8 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 6-[(4R,6aR,9aS,9bR)-2-hydroxy-4-[(E)-4-[5-(hydroxymethyl)furan-2-yl]-3-methylbut-3-enyl]-5-methyl-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindol-8-yl]hexanoic acid |
| SMILES | CC1=C2[C@@H](CC/C(C)=C/c3ccc(CO)o3)OB(O)C[C@@H]2[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C27H36BNO8/c1-16(12-18-8-9-19(15-30)36-18)7-10-22-24-17(2)13-20-25(21(24)14-28(35)37-22)27(34)29(26(20)33)11-5-3-4-6-23(31)32/h8-9,12,20-22,25,30,35H,3-7,10-11,13-15H2,1-2H3,(H,31,32)/b16-12+/t20-,21+,22-,25-/m1/s1 |
| InChIKey | OHGPECNCNSHSSW-VRGAHTIOSA-N |
| XLogP | 3.42 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|