C33H41BN2O5 — CID 135555758
(4R,6aR,9aS,9bR)-2-hydroxy-4-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-5,8-dipropyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione (PubChem CID 135555758) has the molecular formula C33H41BN2O5 and a molecular weight of 556.51 g/mol. Its IUPAC name is (4R,6aR,9aS,9bR)-2-hydroxy-4-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-5,8-dipropyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione.
| Compound Name | (4R,6aR,9aS,9bR)-2-hydroxy-4-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-5,8-dipropyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
|---|---|
| PubChem CID | 135555758 |
| Molecular Formula | C33H41BN2O5 |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | (4R,6aR,9aS,9bR)-2-hydroxy-4-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-5,8-dipropyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3cc(C)c(O)c(C)c3)c3ccccn3)OB(O)C[C@@H]2[C@@H]2C(=O)N(CCC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H41BN2O5/c1-5-9-24-18-25-30(33(39)36(14-6-2)32(25)38)26-19-34(40)41-28(29(24)26)12-11-23(27-10-7-8-13-35-27)17-22-15-20(3)31(37)21(4)16-22/h7-8,10,13,15-17,25-26,28,30,37,40H,5-6,9,11-12,14,18-19H2,1-4H3/b23-17-/t25-,26+,28-,30-/m1/s1 |
| InChIKey | QKEIQKHXJIKKMG-OLCXANPRSA-N |
| XLogP | 5.73 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|