C29H32BFN2O5 — CID 135754781
(4R,6aR,9aS,9bR)-4-[(Z)-4-(3-fluoro-4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-2-hydroxy-5-methyl-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione (PubChem CID 135754781) has the molecular formula C29H32BFN2O5 and a molecular weight of 518.39 g/mol. Its IUPAC name is (4R,6aR,9aS,9bR)-4-[(Z)-4-(3-fluoro-4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-2-hydroxy-5-methyl-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione.
| Compound Name | (4R,6aR,9aS,9bR)-4-[(Z)-4-(3-fluoro-4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-2-hydroxy-5-methyl-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
|---|---|
| PubChem CID | 135754781 |
| Molecular Formula | C29H32BFN2O5 |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | (4R,6aR,9aS,9bR)-4-[(Z)-4-(3-fluoro-4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-2-hydroxy-5-methyl-8-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
| SMILES | CCCN1C(=O)[C@@H]2[C@@H](CC(C)=C3[C@@H](CC/C(=C/c4ccc(O)c(F)c4)c4ccccn4)OB(O)C[C@@H]32)C1=O |
| InChI | InChI=1S/C29H32BFN2O5/c1-3-12-33-28(35)20-13-17(2)26-21(27(20)29(33)36)16-30(37)38-25(26)10-8-19(23-6-4-5-11-32-23)14-18-7-9-24(34)22(31)15-18/h4-7,9,11,14-15,20-21,25,27,34,37H,3,8,10,12-13,16H2,1-2H3/b19-14-/t20-,21+,25-,27-/m1/s1 |
| InChIKey | AOSSZDYANFKDRK-RMSXYJIGSA-N |
| XLogP | 4.47 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|