C30H32BFN2O7 — CID 135846796
methyl (4R,6aR,9aS,9bR)-4-[(Z)-4-(3-fluoro-4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-2-hydroxy-7,9-dioxo-5-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate (PubChem CID 135846796) has the molecular formula C30H32BFN2O7 and a molecular weight of 562.40 g/mol. Its IUPAC name is methyl (4R,6aR,9aS,9bR)-4-[(Z)-4-(3-fluoro-4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-2-hydroxy-7,9-dioxo-5-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate.
| Compound Name | methyl (4R,6aR,9aS,9bR)-4-[(Z)-4-(3-fluoro-4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-2-hydroxy-7,9-dioxo-5-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
|---|---|
| PubChem CID | 135846796 |
| Molecular Formula | C30H32BFN2O7 |
| Molecular Weight | 562.40 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | methyl (4R,6aR,9aS,9bR)-4-[(Z)-4-(3-fluoro-4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-2-hydroxy-7,9-dioxo-5-propyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3ccc(O)c(F)c3)c3ccccn3)OB(O)C[C@@H]2[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C30H32BFN2O7/c1-3-6-19-15-20-27(29(37)34(28(20)36)30(38)40-2)21-16-31(39)41-25(26(19)21)11-9-18(23-7-4-5-12-33-23)13-17-8-10-24(35)22(32)14-17/h4-5,7-8,10,12-14,20-21,25,27,35,39H,3,6,9,11,15-16H2,1-2H3/b18-13-/t20-,21+,25-,27-/m1/s1 |
| InChIKey | RLCHWCPVHXPYBZ-JDEAEAJLSA-N |
| XLogP | 4.61 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|