C32H37BO5 — CID 23775847
(4R,6aR,12aS,12bR)-2-hydroxy-4-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-5-propyl-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione (PubChem CID 23775847) has the molecular formula C32H37BO5 and a molecular weight of 512.46 g/mol. Its IUPAC name is (4R,6aR,12aS,12bR)-2-hydroxy-4-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-5-propyl-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione.
| Compound Name | (4R,6aR,12aS,12bR)-2-hydroxy-4-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-5-propyl-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione |
|---|---|
| PubChem CID | 23775847 |
| Molecular Formula | C32H37BO5 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | (4R,6aR,12aS,12bR)-2-hydroxy-4-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-5-propyl-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3cccc(O)c3)CCC)OB(O)C[C@@H]2[C@@H]2C(=O)c3ccccc3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C32H37BO5/c1-3-8-20(16-21-10-7-11-23(34)17-21)14-15-28-29-22(9-4-2)18-26-30(27(29)19-33(37)38-28)32(36)25-13-6-5-12-24(25)31(26)35/h5-7,10-13,16-17,26-28,30,34,37H,3-4,8-9,14-15,18-19H2,1-2H3/b20-16+/t26-,27+,28-,30-/m1/s1 |
| InChIKey | DOXXBVZQVOCNJL-NSWNXLPESA-N |
| XLogP | 6.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|