C30H32BFO5 — CID 23746725
(4R,6aR,12aS,12bR)-5-ethyl-4-[(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]pentyl]-2-hydroxy-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione (PubChem CID 23746725) has the molecular formula C30H32BFO5 and a molecular weight of 502.39 g/mol. Its IUPAC name is (4R,6aR,12aS,12bR)-5-ethyl-4-[(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]pentyl]-2-hydroxy-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione.
| Compound Name | (4R,6aR,12aS,12bR)-5-ethyl-4-[(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]pentyl]-2-hydroxy-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione |
|---|---|
| PubChem CID | 23746725 |
| Molecular Formula | C30H32BFO5 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | (4R,6aR,12aS,12bR)-5-ethyl-4-[(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]pentyl]-2-hydroxy-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccc(O)c(F)c3)CC)OB(O)C[C@@H]2[C@@H]2C(=O)c3ccccc3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C30H32BFO5/c1-3-17(13-18-9-11-25(33)24(32)14-18)10-12-26-27-19(4-2)15-22-28(23(27)16-31(36)37-26)30(35)21-8-6-5-7-20(21)29(22)34/h5-9,11,13-14,22-23,26,28,33,36H,3-4,10,12,15-16H2,1-2H3/b17-13+/t22-,23+,26-,28-/m1/s1 |
| InChIKey | QWKHGRTUPLEZBP-OFOIGUCASA-N |
| XLogP | 6.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|