C38H41NO7 — CID 23862983
6-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxynaphthalen-1-yl)-3-phenylbut-3-enyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid (PubChem CID 23862983) has the molecular formula C38H41NO7 and a molecular weight of 623.75 g/mol. Its IUPAC name is 6-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxynaphthalen-1-yl)-3-phenylbut-3-enyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid.
| Compound Name | 6-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxynaphthalen-1-yl)-3-phenylbut-3-enyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 23862983 |
| Molecular Formula | C38H41NO7 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 6-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxynaphthalen-1-yl)-3-phenylbut-3-enyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
| SMILES | COCC1=C2[C@@H](CC/C(=C/c3ccc(O)c4ccccc34)c3ccccc3)OC[C@@H]2[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C38H41NO7/c1-45-22-27-21-30-36(38(44)39(37(30)43)19-9-3-6-14-34(41)42)31-23-46-33(35(27)31)18-16-25(24-10-4-2-5-11-24)20-26-15-17-32(40)29-13-8-7-12-28(26)29/h2,4-5,7-8,10-13,15,17,20,30-31,33,36,40H,3,6,9,14,16,18-19,21-23H2,1H3,(H,41,42)/b25-20-/t30-,31+,33-,36-/m1/s1 |
| InChIKey | QJTYPEOFJSVGSZ-WYDLZINASA-N |
| XLogP | 6.47 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|