C34H40N2O6 — CID 23834373
6-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(3-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-6,8-dioxo-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid (PubChem CID 23834373) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is 6-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(3-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-6,8-dioxo-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid.
| Compound Name | 6-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(3-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-6,8-dioxo-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 23834373 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 6-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(3-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-6,8-dioxo-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3cccc(O)c3)c3ccccn3)OC[C@@H]2[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C34H40N2O6/c1-2-9-24-20-26-32(34(41)36(33(26)40)17-7-3-4-13-30(38)39)27-21-42-29(31(24)27)15-14-23(28-12-5-6-16-35-28)18-22-10-8-11-25(37)19-22/h5-6,8,10-12,16,18-19,26-27,29,32,37H,2-4,7,9,13-15,17,20-21H2,1H3,(H,38,39)/b23-18-/t26-,27+,29-,32-/m1/s1 |
| InChIKey | CNGGSAKXRDGHGS-QPQAJETOSA-N |
| XLogP | 5.87 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|