C32H31BN2O6 — CID 135787219
(4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-8-phenyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione (PubChem CID 135787219) has the molecular formula C32H31BN2O6 and a molecular weight of 550.42 g/mol. Its IUPAC name is (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-8-phenyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione.
| Compound Name | (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-8-phenyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
|---|---|
| PubChem CID | 135787219 |
| Molecular Formula | C32H31BN2O6 |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | (4R,6aR,9aS,9bR)-2-hydroxy-5-(hydroxymethyl)-4-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-8-phenyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
| SMILES | O=C1[C@@H]2[C@@H](CC(CO)=C3[C@@H](CC/C(=C/c4ccccc4O)c4ccccn4)OB(O)C[C@@H]32)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C32H31BN2O6/c36-19-22-17-24-30(32(39)35(31(24)38)23-9-2-1-3-10-23)25-18-33(40)41-28(29(22)25)14-13-20(26-11-6-7-15-34-26)16-21-8-4-5-12-27(21)37/h1-12,15-16,24-25,28,30,36-37,40H,13-14,17-19H2/b20-16-/t24-,25+,28-,30-/m1/s1 |
| InChIKey | SNJFCJKVTDBGIB-PWHMYORQSA-N |
| XLogP | 4.10 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|