C35H41ClN2O4 — CID 23918690
(3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-3-[(3E)-3-[(2-chloro-4-hydroxyphenyl)methylidene]pentyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23918690) has the molecular formula C35H41ClN2O4 and a molecular weight of 589.18 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-3-[(3E)-3-[(2-chloro-4-hydroxyphenyl)methylidene]pentyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-3-[(3E)-3-[(2-chloro-4-hydroxyphenyl)methylidene]pentyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23918690 |
| Molecular Formula | C35H41ClN2O4 |
| Molecular Weight | 589.18 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-3-[(3E)-3-[(2-chloro-4-hydroxyphenyl)methylidene]pentyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CC/C(=C\c1ccc(O)cc1Cl)CC[C@H]1OC[C@H]2C1=C(C)C[C@H]1C(=O)N(C3CCN(Cc4ccccc4)CC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C35H41ClN2O4/c1-3-23(18-25-10-11-27(39)19-30(25)36)9-12-31-32-22(2)17-28-33(29(32)21-42-31)35(41)38(34(28)40)26-13-15-37(16-14-26)20-24-7-5-4-6-8-24/h4-8,10-11,18-19,26,28-29,31,33,39H,3,9,12-17,20-21H2,1-2H3/b23-18+/t28-,29+,31-,33-/m1/s1 |
| InChIKey | INCHSXNRRRBKES-KFMILTRZSA-N |
| XLogP | 6.62 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.18 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|