C39H44N2O4 — CID 23805850
(3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]pentyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23805850) has the molecular formula C39H44N2O4 and a molecular weight of 604.79 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]pentyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]pentyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23805850 |
| Molecular Formula | C39H44N2O4 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]pentyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CC/C(=C\c1ccc(O)c2ccccc12)CC[C@H]1OC[C@H]2C1=C(C)C[C@H]1C(=O)N(C3CCN(Cc4ccccc4)CC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C39H44N2O4/c1-3-26(22-28-14-15-34(42)31-12-8-7-11-30(28)31)13-16-35-36-25(2)21-32-37(33(36)24-45-35)39(44)41(38(32)43)29-17-19-40(20-18-29)23-27-9-5-4-6-10-27/h4-12,14-15,22,29,32-33,35,37,42H,3,13,16-21,23-24H2,1-2H3/b26-22+/t32-,33+,35-,37-/m1/s1 |
| InChIKey | MCTAOHDZNYARBE-AFBJFTASSA-N |
| XLogP | 7.12 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|