C33H39NO5 — CID 23918818
(3R,5aR,8aS,8bR)-7-cyclohexyl-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]pentyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23918818) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-cyclohexyl-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]pentyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]pentyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23918818 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]pentyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CC/C(=C\c1ccc(O)c2ccccc12)CC[C@H]1OC[C@H]2C1=C(CO)C[C@H]1C(=O)N(C3CCCCC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C33H39NO5/c1-2-20(16-21-13-14-28(36)25-11-7-6-10-24(21)25)12-15-29-30-22(18-35)17-26-31(27(30)19-39-29)33(38)34(32(26)37)23-8-4-3-5-9-23/h6-7,10-11,13-14,16,23,26-27,29,31,35-36H,2-5,8-9,12,15,17-19H2,1H3/b20-16+/t26-,27+,29-,31-/m1/s1 |
| InChIKey | LWCYTNUNGRADFH-XFFKIIEPSA-N |
| XLogP | 5.76 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|