C30H39NO5 — CID 23890528
(3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]pentyl]-4-(methoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23890528) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]pentyl]-4-(methoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]pentyl]-4-(methoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23890528 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]pentyl]-4-(methoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CC/C(=C\c1ccc(O)cc1)CC[C@H]1OC[C@H]2C1=C(COC)C[C@H]1C(=O)N(C3CCCCC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C30H39NO5/c1-3-19(15-20-9-12-23(32)13-10-20)11-14-26-27-21(17-35-2)16-24-28(25(27)18-36-26)30(34)31(29(24)33)22-7-5-4-6-8-22/h9-10,12-13,15,22,24-26,28,32H,3-8,11,14,16-18H2,1-2H3/b19-15+/t24-,25+,26-,28-/m1/s1 |
| InChIKey | VNOFUKUAZRJYLA-YNNYHNHVSA-N |
| XLogP | 5.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|