C32H36N2O5 — CID 135569355
(3R,5aR,8aS,8bR)-7-cyclohexyl-4-(hydroxymethyl)-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 135569355) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-cyclohexyl-4-(hydroxymethyl)-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-4-(hydroxymethyl)-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 135569355 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-4-(hydroxymethyl)-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | O=C1[C@@H]2[C@@H](CC(CO)=C3[C@@H](CC/C(=C/c4ccc(O)cc4)c4ccccn4)OC[C@@H]32)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C32H36N2O5/c35-18-22-17-25-30(32(38)34(31(25)37)23-6-2-1-3-7-23)26-19-39-28(29(22)26)14-11-21(27-8-4-5-15-33-27)16-20-9-12-24(36)13-10-20/h4-5,8-10,12-13,15-16,23,25-26,28,30,35-36H,1-3,6-7,11,14,17-19H2/b21-16-/t25-,26+,28-,30-/m1/s1 |
| InChIKey | PFBLQDVETYMLKI-XUDHZPARSA-N |
| XLogP | 4.75 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|