C33H33BN2O6 — CID 135799144
[3-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid (PubChem CID 135799144) has the molecular formula C33H33BN2O6 and a molecular weight of 564.45 g/mol. Its IUPAC name is [3-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid.
| Compound Name | [3-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 135799144 |
| Molecular Formula | C33H33BN2O6 |
| Molecular Weight | 564.45 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | [3-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(Z)-4-(2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccccc3O)c3ccccn3)OC[C@@H]2[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H33BN2O6/c1-2-20-17-25-31(33(39)36(32(25)38)24-10-7-9-23(18-24)34(40)41)26-19-42-29(30(20)26)14-13-21(27-11-5-6-15-35-27)16-22-8-3-4-12-28(22)37/h3-12,15-16,18,25-26,29,31,37,40-41H,2,13-14,17,19H2,1H3/b21-16-/t25-,26+,29-,31-/m1/s1 |
| InChIKey | GRUZVXFJETWRPB-AIHXPUMQSA-N |
| XLogP | 3.72 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|