C36H38N2O4 — CID 135760130
(3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-7-phenyl-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 135760130) has the molecular formula C36H38N2O4 and a molecular weight of 562.71 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-7-phenyl-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-7-phenyl-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 135760130 |
| Molecular Formula | C36H38N2O4 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-7-phenyl-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | Cc1cc(/C=C(/CC[C@H]2OC[C@H]3C2=C(C(C)C)C[C@H]2C(=O)N(c4ccccc4)C(=O)[C@H]23)c2ccccn2)cc(C)c1O |
| InChI | InChI=1S/C36H38N2O4/c1-21(2)27-19-28-33(36(41)38(35(28)40)26-10-6-5-7-11-26)29-20-42-31(32(27)29)14-13-25(30-12-8-9-15-37-30)18-24-16-22(3)34(39)23(4)17-24/h5-12,15-18,21,28-29,31,33,39H,13-14,19-20H2,1-4H3/b25-18-/t28-,29+,31-,33-/m1/s1 |
| InChIKey | LKPHSERJKYVNLB-BLLRHENUSA-N |
| XLogP | 6.90 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|