C26H32FNO5 — CID 23974725
(3R,5aR,8aS,8bR)-3-[(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]hexyl]-4-(methoxymethyl)-7-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23974725) has the molecular formula C26H32FNO5 and a molecular weight of 457.54 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]hexyl]-4-(methoxymethyl)-7-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]hexyl]-4-(methoxymethyl)-7-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23974725 |
| Molecular Formula | C26H32FNO5 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(3E)-3-[(3-fluoro-4-hydroxyphenyl)methylidene]hexyl]-4-(methoxymethyl)-7-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCC/C(=C\c1ccc(O)c(F)c1)CC[C@H]1OC[C@H]2C1=C(COC)C[C@H]1C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H32FNO5/c1-4-5-15(10-16-6-8-21(29)20(27)11-16)7-9-22-23-17(13-32-3)12-18-24(19(23)14-33-22)26(31)28(2)25(18)30/h6,8,10-11,18-19,22,24,29H,4-5,7,9,12-14H2,1-3H3/b15-10+/t18-,19+,22-,24-/m1/s1 |
| InChIKey | BWQMWFYOVMJJLM-IBLXGHPCSA-N |
| XLogP | 4.09 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|