C31H33NO6 — CID 23834367
methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate (PubChem CID 23834367) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate.
| Compound Name | methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate |
|---|---|
| PubChem CID | 23834367 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3ccc(O)cc3)c3ccccc3)OC[C@@H]2[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C31H33NO6/c1-3-7-22-17-24-28(30(35)32(29(24)34)31(36)37-2)25-18-38-26(27(22)25)15-12-21(20-8-5-4-6-9-20)16-19-10-13-23(33)14-11-19/h4-6,8-11,13-14,16,24-26,28,33H,3,7,12,15,17-18H2,1-2H3/b21-16-/t24-,25+,26-,28-/m1/s1 |
| InChIKey | FKAXIGHELBMSAM-KPFMWYTFSA-N |
| XLogP | 5.60 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|