C30H33NO7 — CID 23974294
methyl (3aS,4R,7aR)-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 23974294) has the molecular formula C30H33NO7 and a molecular weight of 519.59 g/mol. Its IUPAC name is methyl (3aS,4R,7aR)-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | methyl (3aS,4R,7aR)-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 23974294 |
| Molecular Formula | C30H33NO7 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | methyl (3aS,4R,7aR)-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | CCC1=C([C@H](O)CC/C(=C/c2ccccc2O)c2ccccc2)[C@H](CO)[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C30H33NO7/c1-3-18-16-22-27(29(36)31(28(22)35)30(37)38-2)23(17-32)26(18)25(34)14-13-20(19-9-5-4-6-10-19)15-21-11-7-8-12-24(21)33/h4-12,15,22-23,25,27,32-34H,3,13-14,16-17H2,1-2H3/b20-15-/t22-,23+,25-,27-/m1/s1 |
| InChIKey | QMIORTTULWAPOJ-RSSIOCEASA-N |
| XLogP | 4.16 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|