C32H38N2O7 — CID 135832193
methyl (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propyl-3a,4,7,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 135832193) has the molecular formula C32H38N2O7 and a molecular weight of 562.66 g/mol. Its IUPAC name is methyl (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propyl-3a,4,7,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | methyl (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propyl-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 135832193 |
| Molecular Formula | C32H38N2O7 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | methyl (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propyl-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | CCCC1=C([C@H](O)CC/C(=C/c2cc(C)c(O)c(C)c2)c2ccccn2)[C@H](CO)[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C32H38N2O7/c1-5-8-22-16-23-28(31(39)34(30(23)38)32(40)41-4)24(17-35)27(22)26(36)11-10-21(25-9-6-7-12-33-25)15-20-13-18(2)29(37)19(3)14-20/h6-7,9,12-15,23-24,26,28,35-37H,5,8,10-11,16-17H2,1-4H3/b21-15-/t23-,24+,26-,28-/m1/s1 |
| InChIKey | QLJUKAXCOYLQFC-FGGCQQKOSA-N |
| XLogP | 4.56 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|