C37H47NO5 — CID 23834195
(3aS,4R,7aR)-2-cyclohexyl-5-[(Z,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23834195) has the molecular formula C37H47NO5 and a molecular weight of 585.79 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-cyclohexyl-5-[(Z,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(Z,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23834195 |
| Molecular Formula | C37H47NO5 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.35 |
| IUPAC Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(Z,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCC1=C([C@H](O)CC/C(=C/c2cc(C)c(O)c(C)c2)c2ccccc2)[C@H](CO)[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C37H47NO5/c1-4-11-28-21-30-34(37(43)38(36(30)42)29-14-9-6-10-15-29)31(22-39)33(28)32(40)17-16-27(26-12-7-5-8-13-26)20-25-18-23(2)35(41)24(3)19-25/h5,7-8,12-13,18-20,29-32,34,39-41H,4,6,9-11,14-17,21-22H2,1-3H3/b27-20-/t30-,31+,32-,34-/m1/s1 |
| InChIKey | STMFAYWEDUYYBG-AMVNUXTESA-N |
| XLogP | 6.73 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|