C35H36BrNO5 — CID 23776433
(3aS,4R,7aR)-5-[(Z,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23776433) has the molecular formula C35H36BrNO5 and a molecular weight of 630.58 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(Z,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(Z,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23776433 |
| Molecular Formula | C35H36BrNO5 |
| Molecular Weight | 630.58 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | (3aS,4R,7aR)-5-[(Z,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCC1=C([C@H](O)CC/C(=C/c2cc(Br)ccc2O)c2ccccc2)[C@H](CO)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C35H36BrNO5/c1-2-9-24-20-28-33(35(42)37(34(28)41)27-12-7-4-8-13-27)29(21-38)32(24)31(40)16-14-23(22-10-5-3-6-11-22)18-25-19-26(36)15-17-30(25)39/h3-8,10-13,15,17-19,28-29,31,33,38-40H,2,9,14,16,20-21H2,1H3/b23-18-/t28-,29+,31-,33-/m1/s1 |
| InChIKey | HOKMVAMVSKKERS-RSUSSBPBSA-N |
| XLogP | 6.75 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|