C30H34ClNO5 — CID 23918391
(3aS,4R,7aR)-5-[(E,1R)-5-(2-chloro-4-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23918391) has the molecular formula C30H34ClNO5 and a molecular weight of 524.06 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(E,1R)-5-(2-chloro-4-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(E,1R)-5-(2-chloro-4-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23918391 |
| Molecular Formula | C30H34ClNO5 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (3aS,4R,7aR)-5-[(E,1R)-5-(2-chloro-4-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCC1=C([C@H](O)CC/C(C)=C/c2ccc(O)cc2Cl)[C@H](CO)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C30H34ClNO5/c1-3-7-20-15-23-28(30(37)32(29(23)36)21-8-5-4-6-9-21)24(17-33)27(20)26(35)13-10-18(2)14-19-11-12-22(34)16-25(19)31/h4-6,8-9,11-12,14,16,23-24,26,28,33-35H,3,7,10,13,15,17H2,1-2H3/b18-14+/t23-,24+,26-,28-/m1/s1 |
| InChIKey | QYFARSOKEXVBEC-ZGLLCSJTSA-N |
| XLogP | 5.50 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|