C28H31NO6 — CID 23974221
(3aS,4R,7aR)-5-[(E,1R)-1-hydroxy-5-(4-hydroxyphenyl)-4-methylpent-4-enyl]-4,6-bis(hydroxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23974221) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(E,1R)-1-hydroxy-5-(4-hydroxyphenyl)-4-methylpent-4-enyl]-4,6-bis(hydroxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(E,1R)-1-hydroxy-5-(4-hydroxyphenyl)-4-methylpent-4-enyl]-4,6-bis(hydroxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23974221 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (3aS,4R,7aR)-5-[(E,1R)-1-hydroxy-5-(4-hydroxyphenyl)-4-methylpent-4-enyl]-4,6-bis(hydroxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C/C(=C\c1ccc(O)cc1)CC[C@@H](O)C1=C(CO)C[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C28H31NO6/c1-17(13-18-8-10-21(32)11-9-18)7-12-24(33)25-19(15-30)14-22-26(23(25)16-31)28(35)29(27(22)34)20-5-3-2-4-6-20/h2-6,8-11,13,22-24,26,30-33H,7,12,14-16H2,1H3/b17-13+/t22-,23+,24-,26-/m1/s1 |
| InChIKey | JDFVFVHBZILCKT-FUSBAVCMSA-N |
| XLogP | 3.04 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|