C29H32ClNO5 — CID 23918396
(3aS,4R,7aR)-5-[(1R,4E)-4-[(2-chloro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-6-methyl-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23918396) has the molecular formula C29H32ClNO5 and a molecular weight of 510.03 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(1R,4E)-4-[(2-chloro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-6-methyl-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(2-chloro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-6-methyl-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23918396 |
| Molecular Formula | C29H32ClNO5 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(2-chloro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-6-methyl-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC/C(=C\c1ccc(O)cc1Cl)CC[C@@H](O)C1=C(C)C[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C29H32ClNO5/c1-3-18(14-19-10-11-21(33)15-24(19)30)9-12-25(34)26-17(2)13-22-27(23(26)16-32)29(36)31(28(22)35)20-7-5-4-6-8-20/h4-8,10-11,14-15,22-23,25,27,32-34H,3,9,12-13,16H2,1-2H3/b18-14+/t22-,23+,25-,27-/m1/s1 |
| InChIKey | LAUNEHNOXSMZRK-KKXRBHQQSA-N |
| XLogP | 5.11 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|