C31H31F6NO5 — CID 23862468
(3aS,4R,7aR)-2-[3,5-bis(trifluoromethyl)phenyl]-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23862468) has the molecular formula C31H31F6NO5 and a molecular weight of 611.58 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-[3,5-bis(trifluoromethyl)phenyl]-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-[3,5-bis(trifluoromethyl)phenyl]-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23862468 |
| Molecular Formula | C31H31F6NO5 |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | (3aS,4R,7aR)-2-[3,5-bis(trifluoromethyl)phenyl]-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC/C(=C\c1cccc(O)c1)CC[C@@H](O)C1=C(C)C[C@H]2C(=O)N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C31H31F6NO5/c1-3-17(10-18-5-4-6-22(40)11-18)7-8-25(41)26-16(2)9-23-27(24(26)15-39)29(43)38(28(23)42)21-13-19(30(32,33)34)12-20(14-21)31(35,36)37/h4-6,10-14,23-25,27,39-41H,3,7-9,15H2,1-2H3/b17-10+/t23-,24+,25-,27-/m1/s1 |
| InChIKey | HEDUOPGORLSEII-MAANFNMOSA-N |
| XLogP | 6.50 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|