C27H36ClNO5 — CID 23946356
(3aS,4R,7aR)-5-[(1R,4E)-4-[(2-chloro-4-hydroxyphenyl)methylidene]-1-hydroxyheptyl]-4-(hydroxymethyl)-2-methyl-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23946356) has the molecular formula C27H36ClNO5 and a molecular weight of 490.04 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(1R,4E)-4-[(2-chloro-4-hydroxyphenyl)methylidene]-1-hydroxyheptyl]-4-(hydroxymethyl)-2-methyl-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(2-chloro-4-hydroxyphenyl)methylidene]-1-hydroxyheptyl]-4-(hydroxymethyl)-2-methyl-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23946356 |
| Molecular Formula | C27H36ClNO5 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(2-chloro-4-hydroxyphenyl)methylidene]-1-hydroxyheptyl]-4-(hydroxymethyl)-2-methyl-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCC/C(=C\c1ccc(O)cc1Cl)CC[C@@H](O)C1=C(C(C)C)C[C@H]2C(=O)N(C)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C27H36ClNO5/c1-5-6-16(11-17-8-9-18(31)12-22(17)28)7-10-23(32)24-19(15(2)3)13-20-25(21(24)14-30)27(34)29(4)26(20)33/h8-9,11-12,15,20-21,23,25,30-32H,5-7,10,13-14H2,1-4H3/b16-11+/t20-,21+,23-,25-/m1/s1 |
| InChIKey | QIMSUDPATIAVRY-OCJPHPMISA-N |
| XLogP | 4.57 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|