C31H39NO5S — CID 23918313
(3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(2-hydroxyphenyl)methylidene]heptyl]-4-(hydroxymethyl)-6-propan-2-yl-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23918313) has the molecular formula C31H39NO5S and a molecular weight of 537.72 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(2-hydroxyphenyl)methylidene]heptyl]-4-(hydroxymethyl)-6-propan-2-yl-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(2-hydroxyphenyl)methylidene]heptyl]-4-(hydroxymethyl)-6-propan-2-yl-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23918313 |
| Molecular Formula | C31H39NO5S |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(2-hydroxyphenyl)methylidene]heptyl]-4-(hydroxymethyl)-6-propan-2-yl-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCC/C(=C\c1ccccc1O)CC[C@@H](O)C1=C(C(C)C)C[C@H]2C(=O)N(Cc3cccs3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C31H39NO5S/c1-4-8-20(15-21-9-5-6-11-26(21)34)12-13-27(35)28-23(19(2)3)16-24-29(25(28)18-33)31(37)32(30(24)36)17-22-10-7-14-38-22/h5-7,9-11,14-15,19,24-25,27,29,33-35H,4,8,12-13,16-18H2,1-3H3/b20-15+/t24-,25+,27-,29-/m1/s1 |
| InChIKey | KHLZIKJHZFZYQU-UTBMAQIESA-N |
| XLogP | 5.54 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|