C31H32N2O6S — CID 135744899
(3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4,6-bis(hydroxymethyl)-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 135744899) has the molecular formula C31H32N2O6S and a molecular weight of 560.67 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4,6-bis(hydroxymethyl)-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4,6-bis(hydroxymethyl)-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135744899 |
| Molecular Formula | C31H32N2O6S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4,6-bis(hydroxymethyl)-2-(thiophen-2-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@@H](CC(CO)=C([C@H](O)CC/C(=C/c3ccccc3O)c3ccccn3)[C@@H]2CO)C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C31H32N2O6S/c34-17-21-15-23-29(31(39)33(30(23)38)16-22-7-5-13-40-22)24(18-35)28(21)27(37)11-10-19(25-8-3-4-12-32-25)14-20-6-1-2-9-26(20)36/h1-9,12-14,23-24,27,29,34-37H,10-11,15-18H2/b19-14-/t23-,24+,27-,29-/m1/s1 |
| InChIKey | DYJULNJRAKHTQE-WONQEHPSSA-N |
| XLogP | 3.63 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|