C35H43NO7 — CID 23974297
6-[(3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid (PubChem CID 23974297) has the molecular formula C35H43NO7 and a molecular weight of 589.73 g/mol. Its IUPAC name is 6-[(3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 23974297 |
| Molecular Formula | C35H43NO7 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | 6-[(3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
| SMILES | CC(C)C1=C([C@H](O)CC/C(=C/c2ccccc2O)c2ccccc2)[C@H](CO)[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C35H43NO7/c1-22(2)26-20-27-33(35(43)36(34(27)42)18-10-4-7-15-31(40)41)28(21-37)32(26)30(39)17-16-24(23-11-5-3-6-12-23)19-25-13-8-9-14-29(25)38/h3,5-6,8-9,11-14,19,22,27-28,30,33,37-39H,4,7,10,15-18,20-21H2,1-2H3,(H,40,41)/b24-19-/t27-,28+,30-,33-/m1/s1 |
| InChIKey | MUAWIQBUBFEQFI-FNIWEPPNSA-N |
| XLogP | 5.28 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|