C29H38ClNO8 — CID 23974383
6-[(3aS,4R,7aR)-5-[(E,1R)-5-(2-chloro-4-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-(methoxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid (PubChem CID 23974383) has the molecular formula C29H38ClNO8 and a molecular weight of 564.08 g/mol. Its IUPAC name is 6-[(3aS,4R,7aR)-5-[(E,1R)-5-(2-chloro-4-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-(methoxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,4R,7aR)-5-[(E,1R)-5-(2-chloro-4-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-(methoxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 23974383 |
| Molecular Formula | C29H38ClNO8 |
| Molecular Weight | 564.08 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 6-[(3aS,4R,7aR)-5-[(E,1R)-5-(2-chloro-4-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-(methoxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
| SMILES | COCC1=C([C@H](O)CC/C(C)=C/c2ccc(O)cc2Cl)[C@H](CO)[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C29H38ClNO8/c1-17(12-18-8-9-20(33)14-23(18)30)7-10-24(34)26-19(16-39-2)13-21-27(22(26)15-32)29(38)31(28(21)37)11-5-3-4-6-25(35)36/h8-9,12,14,21-22,24,27,32-34H,3-7,10-11,13,15-16H2,1-2H3,(H,35,36)/b17-12+/t21-,22+,24-,27-/m1/s1 |
| InChIKey | YPLOQINGIPCSSD-GAYFAFNSSA-N |
| XLogP | 3.79 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.08 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|