C32H45NO7 — CID 23918367
6-[(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid (PubChem CID 23918367) has the molecular formula C32H45NO7 and a molecular weight of 555.71 g/mol. Its IUPAC name is 6-[(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 23918367 |
| Molecular Formula | C32H45NO7 |
| Molecular Weight | 555.71 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 6-[(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
| SMILES | CCC1=C([C@H](O)CC/C(=C/c2cc(C)c(O)c(C)c2)CC)[C@H](CO)[C@@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C32H45NO7/c1-5-21(16-22-14-19(3)30(38)20(4)15-22)11-12-26(35)28-23(6-2)17-24-29(25(28)18-34)32(40)33(31(24)39)13-9-7-8-10-27(36)37/h14-16,24-26,29,34-35,38H,5-13,17-18H2,1-4H3,(H,36,37)/b21-16+/t24-,25+,26-,29-/m1/s1 |
| InChIKey | KZVDAUKCIATJRR-YMFMUMBJSA-N |
| XLogP | 4.91 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.71 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|